Tetrabutylammonium Hexafluorophosphate (1kg)

Category: Inorganics
SKU: mnd10023-1
Price:
Purity98%
Molecular Formula(CH3CH2CH2CH2)4N(PF6)
Cas Number3109-63-5
MDLMFCD00011748
Einecs221-472-6
Hazard statementsH315-H319-H335
Precautionary statementsP261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501c
Hazardous classIII
Packing class1,2,3